C19H18F2N4O2S — CID 9409353
N-[(Z)-[2-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (PubChem CID 9409353) has the molecular formula C19H18F2N4O2S and a molecular weight of 404.44 g/mol. Its IUPAC name is N-[(Z)-[2-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine.
| Compound Name | N-[(Z)-[2-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
|---|---|
| PubChem CID | 9409353 |
| Molecular Formula | C19H18F2N4O2S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | N-[(Z)-[2-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| SMILES | CCOc1cccc(/C=N\Nc2ncnc3sc4c(c23)CCC4)c1OC(F)F |
| InChI | InChI=1S/C19H18F2N4O2S/c1-2-26-13-7-3-5-11(16(13)27-19(20)21)9-24-25-17-15-12-6-4-8-14(12)28-18(15)23-10-22-17/h3,5,7,9-10,19H,2,4,6,8H2,1H3,(H,22,23,25)/b24-9- |
| InChIKey | NNTHRGCQUVVGJK-OPVMPGTRSA-N |
| XLogP | 4.63 |
| TPSA | 68.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|