C21H18N4S — CID 46174660
N-[(E)-naphthalen-1-ylmethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 46174660) has the molecular formula C21H18N4S and a molecular weight of 358.47 g/mol. Its IUPAC name is N-[(E)-naphthalen-1-ylmethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(E)-naphthalen-1-ylmethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 46174660 |
| Molecular Formula | C21H18N4S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-[(E)-naphthalen-1-ylmethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | C(=N/Nc1ncnc2sc3c(c12)CCCC3)\c1cccc2ccccc12 |
| InChI | InChI=1S/C21H18N4S/c1-2-9-16-14(6-1)7-5-8-15(16)12-24-25-20-19-17-10-3-4-11-18(17)26-21(19)23-13-22-20/h1-2,5-9,12-13H,3-4,10-11H2,(H,22,23,25)/b24-12+ |
| InChIKey | YYOIHQLDXPSXBS-WYMPLXKRSA-N |
| XLogP | 5.17 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|