C17H14Cl2N4OS — CID 135437719
2,4-dichloro-6-[(E)-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylhydrazinylidene)methyl]phenol (PubChem CID 135437719) has the molecular formula C17H14Cl2N4OS and a molecular weight of 393.30 g/mol. Its IUPAC name is 2,4-dichloro-6-[(E)-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylhydrazinylidene)methyl]phenol.
| Compound Name | 2,4-dichloro-6-[(E)-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylhydrazinylidene)methyl]phenol |
|---|---|
| PubChem CID | 135437719 |
| Molecular Formula | C17H14Cl2N4OS |
| Molecular Weight | 393.30 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 2,4-dichloro-6-[(E)-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylhydrazinylidene)methyl]phenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1/C=N/Nc1ncnc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C17H14Cl2N4OS/c18-10-5-9(15(24)12(19)6-10)7-22-23-16-14-11-3-1-2-4-13(11)25-17(14)21-8-20-16/h5-8,24H,1-4H2,(H,20,21,23)/b22-7+ |
| InChIKey | MHNMUYLLTIZKIE-QPJQQBGISA-N |
| XLogP | 5.03 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.30 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|