C21H18ClN5OS — CID 3816268
N-[(2-chloro-6-methoxyquinolin-3-yl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 3816268) has the molecular formula C21H18ClN5OS and a molecular weight of 423.93 g/mol. Its IUPAC name is N-[(2-chloro-6-methoxyquinolin-3-yl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(2-chloro-6-methoxyquinolin-3-yl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 3816268 |
| Molecular Formula | C21H18ClN5OS |
| Molecular Weight | 423.93 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | N-[(2-chloro-6-methoxyquinolin-3-yl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | COc1ccc2nc(Cl)c(C=NNc3ncnc4sc5c(c34)CCCC5)cc2c1 |
| InChI | InChI=1S/C21H18ClN5OS/c1-28-14-6-7-16-12(9-14)8-13(19(22)26-16)10-25-27-20-18-15-4-2-3-5-17(15)29-21(18)24-11-23-20/h6-11H,2-5H2,1H3,(H,23,24,27) |
| InChIKey | AFSVMSYNNVNFJN-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.93 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|