C21H17N5O3S — CID 135651238
7-[(E)-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylhydrazinylidene)methyl]-5H-[1,3]dioxolo[4,5-g]quinolin-6-one (PubChem CID 135651238) has the molecular formula C21H17N5O3S and a molecular weight of 419.47 g/mol. Its IUPAC name is 7-[(E)-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylhydrazinylidene)methyl]-5H-[1,3]dioxolo[4,5-g]quinolin-6-one.
| Compound Name | 7-[(E)-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylhydrazinylidene)methyl]-5H-[1,3]dioxolo[4,5-g]quinolin-6-one |
|---|---|
| PubChem CID | 135651238 |
| Molecular Formula | C21H17N5O3S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 7-[(E)-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylhydrazinylidene)methyl]-5H-[1,3]dioxolo[4,5-g]quinolin-6-one |
| SMILES | O=c1[nH]c2cc3c(cc2cc1/C=N/Nc1ncnc2sc4c(c12)CCCC4)OCO3 |
| InChI | InChI=1S/C21H17N5O3S/c27-20-12(5-11-6-15-16(29-10-28-15)7-14(11)25-20)8-24-26-19-18-13-3-1-2-4-17(13)30-21(18)23-9-22-19/h5-9H,1-4,10H2,(H,25,27)(H,22,23,26)/b24-8+ |
| InChIKey | XDVOKNSMGUBUNT-KTZMUZOWSA-N |
| XLogP | 3.59 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|