C23H23BrN4O2S — CID 46174715
N-[(E)-[4-bromo-3,5-bis(prop-2-enoxy)phenyl]methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 46174715) has the molecular formula C23H23BrN4O2S and a molecular weight of 499.43 g/mol. Its IUPAC name is N-[(E)-[4-bromo-3,5-bis(prop-2-enoxy)phenyl]methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(E)-[4-bromo-3,5-bis(prop-2-enoxy)phenyl]methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 46174715 |
| Molecular Formula | C23H23BrN4O2S |
| Molecular Weight | 499.43 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | N-[(E)-[4-bromo-3,5-bis(prop-2-enoxy)phenyl]methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | C=CCOc1cc(/C=N/Nc2ncnc3sc4c(c23)CCCC4)cc(OCC=C)c1Br |
| InChI | InChI=1S/C23H23BrN4O2S/c1-3-9-29-17-11-15(12-18(21(17)24)30-10-4-2)13-27-28-22-20-16-7-5-6-8-19(16)31-23(20)26-14-25-22/h3-4,11-14H,1-2,5-10H2,(H,25,26,28)/b27-13+ |
| InChIKey | JNWKAKTVAACCHF-UVHMKAGCSA-N |
| XLogP | 5.91 |
| TPSA | 68.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.43 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|