C18H15N4O3S- — CID 9409283
2-[4-[(Z)-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylhydrazinylidene)methyl]phenoxy]acetate (PubChem CID 9409283) has the molecular formula C18H15N4O3S- and a molecular weight of 367.41 g/mol. Its IUPAC name is 2-[4-[(Z)-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylhydrazinylidene)methyl]phenoxy]acetate.
| Compound Name | 2-[4-[(Z)-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylhydrazinylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 9409283 |
| Molecular Formula | C18H15N4O3S- |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 2-[4-[(Z)-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylhydrazinylidene)methyl]phenoxy]acetate |
| SMILES | O=C([O-])COc1ccc(/C=N\Nc2ncnc3sc4c(c23)CCC4)cc1 |
| InChI | InChI=1S/C18H16N4O3S/c23-15(24)9-25-12-6-4-11(5-7-12)8-21-22-17-16-13-2-1-3-14(13)26-18(16)20-10-19-17/h4-8,10H,1-3,9H2,(H,23,24)(H,19,20,22)/p-1/b21-8- |
| InChIKey | ZYYJXFYRLSFBMI-WNFQYIGGSA-M |
| XLogP | 1.75 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|