C16H22N5S+ — CID 6948266
N-[(1-methylpiperidin-1-ium-4-ylidene)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 6948266) has the molecular formula C16H22N5S+ and a molecular weight of 316.45 g/mol. Its IUPAC name is N-[(1-methylpiperidin-1-ium-4-ylidene)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(1-methylpiperidin-1-ium-4-ylidene)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 6948266 |
| Molecular Formula | C16H22N5S+ |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | N-[(1-methylpiperidin-1-ium-4-ylidene)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | C[NH+]1CCC(=NNc2ncnc3sc4c(c23)CCCC4)CC1 |
| InChI | InChI=1S/C16H21N5S/c1-21-8-6-11(7-9-21)19-20-15-14-12-4-2-3-5-13(12)22-16(14)18-10-17-15/h10H,2-9H2,1H3,(H,17,18,20)/p+1 |
| InChIKey | QOAOLFXQTAXDMA-UHFFFAOYSA-O |
| XLogP | 1.65 |
| TPSA | 54.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|