C19H22N4OS — CID 2466329
N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (PubChem CID 2466329) has the molecular formula C19H22N4OS and a molecular weight of 354.48 g/mol. Its IUPAC name is N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine.
| Compound Name | N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
|---|---|
| PubChem CID | 2466329 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| SMILES | c1coc([C@H](CNc2ncnc3sc4c(c23)CCC4)N2CCCC2)c1 |
| InChI | InChI=1S/C19H22N4OS/c1-2-9-23(8-1)14(15-6-4-10-24-15)11-20-18-17-13-5-3-7-16(13)25-19(17)22-12-21-18/h4,6,10,12,14H,1-3,5,7-9,11H2,(H,20,21,22)/t14-/m0/s1 |
| InChIKey | MXYGIZIIOCUYNR-AWEZNQCLSA-N |
| XLogP | 4.02 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |