C15H22N4S — CID 133289628
N'-tert-butyl-N-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)ethane-1,2-diamine (PubChem CID 133289628) has the molecular formula C15H22N4S and a molecular weight of 290.44 g/mol. Its IUPAC name is N'-tert-butyl-N-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)ethane-1,2-diamine.
| Compound Name | N'-tert-butyl-N-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 133289628 |
| Molecular Formula | C15H22N4S |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N'-tert-butyl-N-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)ethane-1,2-diamine |
| SMILES | CC(C)(C)NCCNc1ncnc2sc3c(c12)CCC3 |
| InChI | InChI=1S/C15H22N4S/c1-15(2,3)19-8-7-16-13-12-10-5-4-6-11(10)20-14(12)18-9-17-13/h9,19H,4-8H2,1-3H3,(H,16,17,18) |
| InChIKey | TYUJPUKRERWWPW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|