C16H25N4S+ — CID 9311624
[2,2-dimethyl-3-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)propyl]-dimethylazanium (PubChem CID 9311624) has the molecular formula C16H25N4S+ and a molecular weight of 305.47 g/mol. Its IUPAC name is [2,2-dimethyl-3-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)propyl]-dimethylazanium.
| Compound Name | [2,2-dimethyl-3-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)propyl]-dimethylazanium |
|---|---|
| PubChem CID | 9311624 |
| Molecular Formula | C16H25N4S+ |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | [2,2-dimethyl-3-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)propyl]-dimethylazanium |
| SMILES | C[NH+](C)CC(C)(C)CNc1ncnc2sc3c(c12)CCC3 |
| InChI | InChI=1S/C16H24N4S/c1-16(2,9-20(3)4)8-17-14-13-11-6-5-7-12(11)21-15(13)19-10-18-14/h10H,5-9H2,1-4H3,(H,17,18,19)/p+1 |
| InChIKey | LXSASEZQZYTKEF-UHFFFAOYSA-O |
| XLogP | 1.76 |
| TPSA | 42.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |