C13H13Cl2N3S — CID 2517603
N-[[(1R)-2,2-dichlorocyclopropyl]methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (PubChem CID 2517603) has the molecular formula C13H13Cl2N3S and a molecular weight of 314.24 g/mol. Its IUPAC name is N-[[(1R)-2,2-dichlorocyclopropyl]methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine.
| Compound Name | N-[[(1R)-2,2-dichlorocyclopropyl]methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
|---|---|
| PubChem CID | 2517603 |
| Molecular Formula | C13H13Cl2N3S |
| Molecular Weight | 314.24 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | N-[[(1R)-2,2-dichlorocyclopropyl]methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| SMILES | ClC1(Cl)C[C@@H]1CNc1ncnc2sc3c(c12)CCC3 |
| InChI | InChI=1S/C13H13Cl2N3S/c14-13(15)4-7(13)5-16-11-10-8-2-1-3-9(8)19-12(10)18-6-17-11/h6-7H,1-5H2,(H,16,17,18)/t7-/m1/s1 |
| InChIKey | COPZYULRFWWCPX-SSDOTTSWSA-N |
| XLogP | 3.79 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.24 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|