C14H21ClN4S — CID 52997951
N',N'-dimethyl-N-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)propane-1,3-diamine;hydrochloride (PubChem CID 52997951) has the molecular formula C14H21ClN4S and a molecular weight of 312.87 g/mol. Its IUPAC name is N',N'-dimethyl-N-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)propane-1,3-diamine;hydrochloride.
| Compound Name | N',N'-dimethyl-N-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)propane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 52997951 |
| Molecular Formula | C14H21ClN4S |
| Molecular Weight | 312.87 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | N',N'-dimethyl-N-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)propane-1,3-diamine;hydrochloride |
| SMILES | CN(C)CCCNc1ncnc2sc3c(c12)CCC3.Cl |
| InChI | InChI=1S/C14H20N4S.ClH/c1-18(2)8-4-7-15-13-12-10-5-3-6-11(10)19-14(12)17-9-16-13;/h9H,3-8H2,1-2H3,(H,15,16,17);1H |
| InChIKey | ACZFKMKTQXAKFA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.87 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|