C19H23N4S+ — CID 9025753
dimethyl-[[2-[(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)methyl]phenyl]methyl]azanium (PubChem CID 9025753) has the molecular formula C19H23N4S+ and a molecular weight of 339.49 g/mol. Its IUPAC name is dimethyl-[[2-[(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)methyl]phenyl]methyl]azanium.
| Compound Name | dimethyl-[[2-[(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)methyl]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 9025753 |
| Molecular Formula | C19H23N4S+ |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | dimethyl-[[2-[(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)methyl]phenyl]methyl]azanium |
| SMILES | C[NH+](C)Cc1ccccc1CNc1ncnc2sc3c(c12)CCC3 |
| InChI | InChI=1S/C19H22N4S/c1-23(2)11-14-7-4-3-6-13(14)10-20-18-17-15-8-5-9-16(15)24-19(17)22-12-21-18/h3-4,6-7,12H,5,8-11H2,1-2H3,(H,20,21,22)/p+1 |
| InChIKey | FLVUZIUSEYGJNH-UHFFFAOYSA-O |
| XLogP | 2.44 |
| TPSA | 42.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |