C18H17N5S — CID 133423010
N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (PubChem CID 133423010) has the molecular formula C18H17N5S and a molecular weight of 335.44 g/mol. Its IUPAC name is N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine.
| Compound Name | N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
|---|---|
| PubChem CID | 133423010 |
| Molecular Formula | C18H17N5S |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | N-[(8-methylimidazo[1,2-a]pyridin-2-yl)methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| SMILES | Cc1cccn2cc(CNc3ncnc4sc5c(c34)CCC5)nc12 |
| InChI | InChI=1S/C18H17N5S/c1-11-4-3-7-23-9-12(22-17(11)23)8-19-16-15-13-5-2-6-14(13)24-18(15)21-10-20-16/h3-4,7,9-10H,2,5-6,8H2,1H3,(H,19,20,21) |
| InChIKey | AIKZRZHDLXKNES-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |