C20H26N6S — CID 133289620
N'-tert-butyl-N-(2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)ethane-1,2-diamine (PubChem CID 133289620) has the molecular formula C20H26N6S and a molecular weight of 382.54 g/mol. Its IUPAC name is N'-tert-butyl-N-(2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)ethane-1,2-diamine.
| Compound Name | N'-tert-butyl-N-(2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 133289620 |
| Molecular Formula | C20H26N6S |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | N'-tert-butyl-N-(2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)ethane-1,2-diamine |
| SMILES | CC(C)(C)NCCNc1nc(-c2cnccn2)nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C20H26N6S/c1-20(2,3)24-11-10-23-18-16-13-6-4-5-7-15(13)27-19(16)26-17(25-18)14-12-21-8-9-22-14/h8-9,12,24H,4-7,10-11H2,1-3H3,(H,23,25,26) |
| InChIKey | ZKYTWMKSAGVEFF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|