C19H23N5S2 — CID 133311451
N-(4-methylsulfanylbutyl)-2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 133311451) has the molecular formula C19H23N5S2 and a molecular weight of 385.56 g/mol. Its IUPAC name is N-(4-methylsulfanylbutyl)-2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(4-methylsulfanylbutyl)-2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133311451 |
| Molecular Formula | C19H23N5S2 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | N-(4-methylsulfanylbutyl)-2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | CSCCCCNc1nc(-c2cnccn2)nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C19H23N5S2/c1-25-11-5-4-8-22-18-16-13-6-2-3-7-15(13)26-19(16)24-17(23-18)14-12-20-9-10-21-14/h9-10,12H,2-8,11H2,1H3,(H,22,23,24) |
| InChIKey | HLASMURWRCRJJB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|