C20H22N8S — CID 133312729
N-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 133312729) has the molecular formula C20H22N8S and a molecular weight of 406.52 g/mol. Its IUPAC name is N-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133312729 |
| Molecular Formula | C20H22N8S |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | N-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2-pyrazin-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC(C)n1cnnc1CNc1nc(-c2cnccn2)nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C20H22N8S/c1-12(2)28-11-24-27-16(28)10-23-19-17-13-5-3-4-6-15(13)29-20(17)26-18(25-19)14-9-21-7-8-22-14/h7-9,11-12H,3-6,10H2,1-2H3,(H,23,25,26) |
| InChIKey | QJTJPXMZLAMMFC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |