C19H16F2N6S — CID 133276569
N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (PubChem CID 133276569) has the molecular formula C19H16F2N6S and a molecular weight of 398.44 g/mol. Its IUPAC name is N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine.
| Compound Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
|---|---|
| PubChem CID | 133276569 |
| Molecular Formula | C19H16F2N6S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| SMILES | FC(F)n1ccnc1CNc1nc(-c2cccnc2)nc2sc3c(c12)CCC3 |
| InChI | InChI=1S/C19H16F2N6S/c20-19(21)27-8-7-23-14(27)10-24-17-15-12-4-1-5-13(12)28-18(15)26-16(25-17)11-3-2-6-22-9-11/h2-3,6-9,19H,1,4-5,10H2,(H,24,25,26) |
| InChIKey | OAESWGXRQHEZQX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |