C21H23N7S — CID 133325293
2-pyridin-3-yl-N-[4-(1,2,4-triazol-4-yl)butyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 133325293) has the molecular formula C21H23N7S and a molecular weight of 405.53 g/mol. Its IUPAC name is 2-pyridin-3-yl-N-[4-(1,2,4-triazol-4-yl)butyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-pyridin-3-yl-N-[4-(1,2,4-triazol-4-yl)butyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133325293 |
| Molecular Formula | C21H23N7S |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 2-pyridin-3-yl-N-[4-(1,2,4-triazol-4-yl)butyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | c1cncc(-c2nc(NCCCCn3cnnc3)c3c4c(sc3n2)CCCC4)c1 |
| InChI | InChI=1S/C21H23N7S/c1-2-8-17-16(7-1)18-20(23-10-3-4-11-28-13-24-25-14-28)26-19(27-21(18)29-17)15-6-5-9-22-12-15/h5-6,9,12-14H,1-4,7-8,10-11H2,(H,23,26,27) |
| InChIKey | IOUUQQQJTDYUTJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|