C22H24N6S — CID 7963240
N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (PubChem CID 7963240) has the molecular formula C22H24N6S and a molecular weight of 404.54 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine.
| Compound Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
|---|---|
| PubChem CID | 7963240 |
| Molecular Formula | C22H24N6S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| SMILES | Cc1cc(C)n(CCCNc2nc(-c3cccnc3)nc3sc4c(c23)CCC4)n1 |
| InChI | InChI=1S/C22H24N6S/c1-14-12-15(2)28(27-14)11-5-10-24-21-19-17-7-3-8-18(17)29-22(19)26-20(25-21)16-6-4-9-23-13-16/h4,6,9,12-13H,3,5,7-8,10-11H2,1-2H3,(H,24,25,26) |
| InChIKey | LRGXZUFVRZWIOI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|