C22H24N4S — CID 7963526
N-[2-(cyclohexen-1-yl)ethyl]-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (PubChem CID 7963526) has the molecular formula C22H24N4S and a molecular weight of 376.53 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
|---|---|
| PubChem CID | 7963526 |
| Molecular Formula | C22H24N4S |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| SMILES | C1=C(CCNc2nc(-c3cccnc3)nc3sc4c(c23)CCC4)CCCC1 |
| InChI | InChI=1S/C22H24N4S/c1-2-6-15(7-3-1)11-13-24-21-19-17-9-4-10-18(17)27-22(19)26-20(25-21)16-8-5-12-23-14-16/h5-6,8,12,14H,1-4,7,9-11,13H2,(H,24,25,26) |
| InChIKey | ZAESNAYUXNAGBA-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|