C20H23N5S — CID 154864887
4-N-(10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)cyclohexane-1,4-diamine (PubChem CID 154864887) has the molecular formula C20H23N5S and a molecular weight of 365.51 g/mol. Its IUPAC name is 4-N-(10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-(10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 154864887 |
| Molecular Formula | C20H23N5S |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 4-N-(10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)cyclohexane-1,4-diamine |
| SMILES | NC1CCC(Nc2nc(-c3cccnc3)nc3sc4c(c23)CCC4)CC1 |
| InChI | InChI=1S/C20H23N5S/c21-13-6-8-14(9-7-13)23-19-17-15-4-1-5-16(15)26-20(17)25-18(24-19)12-3-2-10-22-11-12/h2-3,10-11,13-14H,1,4-9,21H2,(H,23,24,25) |
| InChIKey | QRKHTUQJPPLUKF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |