C22H18N4O2S — CID 7922988
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (PubChem CID 7922988) has the molecular formula C22H18N4O2S and a molecular weight of 402.48 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
|---|---|
| PubChem CID | 7922988 |
| Molecular Formula | C22H18N4O2S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| SMILES | c1cncc(-c2nc(Nc3ccc4c(c3)OCCO4)c3c4c(sc3n2)CCC4)c1 |
| InChI | InChI=1S/C22H18N4O2S/c1-4-15-18(5-1)29-22-19(15)21(25-20(26-22)13-3-2-8-23-12-13)24-14-6-7-16-17(11-14)28-10-9-27-16/h2-3,6-8,11-12H,1,4-5,9-10H2,(H,24,25,26) |
| InChIKey | HEAXFOSCBSZTKI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |