C19H18N6OS — CID 133272549
2-[4-[(10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]pyrazol-1-yl]ethanol (PubChem CID 133272549) has the molecular formula C19H18N6OS and a molecular weight of 378.46 g/mol. Its IUPAC name is 2-[4-[(10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]pyrazol-1-yl]ethanol.
| Compound Name | 2-[4-[(10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 133272549 |
| Molecular Formula | C19H18N6OS |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 2-[4-[(10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]pyrazol-1-yl]ethanol |
| SMILES | OCCn1cc(Nc2nc(-c3cccnc3)nc3sc4c(c23)CCC4)cn1 |
| InChI | InChI=1S/C19H18N6OS/c26-8-7-25-11-13(10-21-25)22-18-16-14-4-1-5-15(14)27-19(16)24-17(23-18)12-3-2-6-20-9-12/h2-3,6,9-11,26H,1,4-5,7-8H2,(H,22,23,24) |
| InChIKey | FMFWXDIVHVYYCK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |