C18H17F3N4OS — CID 75414148
1,1,1-trifluoro-3-[(2-pyridin-3-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]propan-2-ol (PubChem CID 75414148) has the molecular formula C18H17F3N4OS and a molecular weight of 394.42 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[(2-pyridin-3-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[(2-pyridin-3-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 75414148 |
| Molecular Formula | C18H17F3N4OS |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 1,1,1-trifluoro-3-[(2-pyridin-3-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]propan-2-ol |
| SMILES | OC(CNc1nc(-c2cccnc2)nc2sc3c(c12)CCCC3)C(F)(F)F |
| InChI | InChI=1S/C18H17F3N4OS/c19-18(20,21)13(26)9-23-16-14-11-5-1-2-6-12(11)27-17(14)25-15(24-16)10-4-3-7-22-8-10/h3-4,7-8,13,26H,1-2,5-6,9H2,(H,23,24,25) |
| InChIKey | WBCJWCYVNYYCOT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |