C25H28N6S2 — CID 30725743
N-[(2S)-2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (PubChem CID 30725743) has the molecular formula C25H28N6S2 and a molecular weight of 476.68 g/mol. Its IUPAC name is N-[(2S)-2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine.
| Compound Name | N-[(2S)-2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
|---|---|
| PubChem CID | 30725743 |
| Molecular Formula | C25H28N6S2 |
| Molecular Weight | 476.68 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | N-[(2S)-2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| SMILES | CN1CCN([C@@H](CNc2nc(-c3cccnc3)nc3sc4c(c23)CCC4)c2cccs2)CC1 |
| InChI | InChI=1S/C25H28N6S2/c1-30-10-12-31(13-11-30)19(21-8-4-14-32-21)16-27-24-22-18-6-2-7-20(18)33-25(22)29-23(28-24)17-5-3-9-26-15-17/h3-5,8-9,14-15,19H,2,6-7,10-13,16H2,1H3,(H,27,28,29)/t19-/m0/s1 |
| InChIKey | UQBPAFAPWZUKAA-IBGZPJMESA-N |
| XLogP | 4.70 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.68 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |