C24H26N6S — CID 30727958
N-[(2S)-2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 30727958) has the molecular formula C24H26N6S and a molecular weight of 430.58 g/mol. Its IUPAC name is N-[(2S)-2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | N-[(2S)-2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 30727958 |
| Molecular Formula | C24H26N6S |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | N-[(2S)-2-(4-methylpiperazin-1-yl)-2-thiophen-2-ylethyl]-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | CN1CCN([C@@H](CNc2nc(-c3cccnc3)nc3ccccc23)c2cccs2)CC1 |
| InChI | InChI=1S/C24H26N6S/c1-29-11-13-30(14-12-29)21(22-9-5-15-31-22)17-26-24-19-7-2-3-8-20(19)27-23(28-24)18-6-4-10-25-16-18/h2-10,15-16,21H,11-14,17H2,1H3,(H,26,27,28)/t21-/m0/s1 |
| InChIKey | HUGYZANTNTXAAM-NRFANRHFSA-N |
| XLogP | 4.15 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |