C23H23N5OS — CID 31489441
N-[(2R)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 31489441) has the molecular formula C23H23N5OS and a molecular weight of 417.54 g/mol. Its IUPAC name is N-[(2R)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | N-[(2R)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 31489441 |
| Molecular Formula | C23H23N5OS |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | N-[(2R)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | c1cncc(-c2nc(NC[C@H](c3cccs3)N3CCOCC3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C23H23N5OS/c1-2-7-19-18(6-1)23(27-22(26-19)17-5-3-9-24-15-17)25-16-20(21-8-4-14-30-21)28-10-12-29-13-11-28/h1-9,14-15,20H,10-13,16H2,(H,25,26,27)/t20-/m1/s1 |
| InChIKey | GEBHNEXPCSFTJW-HXUWFJFHSA-N |
| XLogP | 4.24 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |