C28H31N5O — CID 121378075
2-[4-(dimethylamino)phenyl]-N-(2-morpholin-4-yl-2-phenylethyl)quinazolin-4-amine (PubChem CID 121378075) has the molecular formula C28H31N5O and a molecular weight of 453.59 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-N-(2-morpholin-4-yl-2-phenylethyl)quinazolin-4-amine.
| Compound Name | 2-[4-(dimethylamino)phenyl]-N-(2-morpholin-4-yl-2-phenylethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 121378075 |
| Molecular Formula | C28H31N5O |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-N-(2-morpholin-4-yl-2-phenylethyl)quinazolin-4-amine |
| SMILES | CN(C)c1ccc(-c2nc(NCC(c3ccccc3)N3CCOCC3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C28H31N5O/c1-32(2)23-14-12-22(13-15-23)27-30-25-11-7-6-10-24(25)28(31-27)29-20-26(21-8-4-3-5-9-21)33-16-18-34-19-17-33/h3-15,26H,16-20H2,1-2H3,(H,29,30,31) |
| InChIKey | LQEQJDLGOWBBIJ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |