C24H25N5OS — CID 86898790
N-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 86898790) has the molecular formula C24H25N5OS and a molecular weight of 431.57 g/mol. Its IUPAC name is N-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | N-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 86898790 |
| Molecular Formula | C24H25N5OS |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | N-[2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | Cc1ccc(C(CNc2nc(-c3cccnc3)nc3ccccc23)N2CCOCC2)s1 |
| InChI | InChI=1S/C24H25N5OS/c1-17-8-9-22(31-17)21(29-11-13-30-14-12-29)16-26-24-19-6-2-3-7-20(19)27-23(28-24)18-5-4-10-25-15-18/h2-10,15,21H,11-14,16H2,1H3,(H,26,27,28) |
| InChIKey | GDPCLQZOCYTRDI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |