C25H25FN5O+ — CID 2553407
N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 2553407) has the molecular formula C25H25FN5O+ and a molecular weight of 430.51 g/mol. Its IUPAC name is N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 2553407 |
| Molecular Formula | C25H25FN5O+ |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | Fc1ccc([C@H](CNc2nc(-c3cccnc3)nc3ccccc23)[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C25H24FN5O/c26-20-9-7-18(8-10-20)23(31-12-14-32-15-13-31)17-28-25-21-5-1-2-6-22(21)29-24(30-25)19-4-3-11-27-16-19/h1-11,16,23H,12-15,17H2,(H,28,29,30)/p+1/t23-/m0/s1 |
| InChIKey | FZXSHGUXTRKGGD-QHCPKHFHSA-O |
| XLogP | 2.90 |
| TPSA | 64.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |