C20H24N5+ — CID 7999462
N-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 7999462) has the molecular formula C20H24N5+ and a molecular weight of 334.45 g/mol. Its IUPAC name is N-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | N-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 7999462 |
| Molecular Formula | C20H24N5+ |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | N-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | CC[NH+]1CCC[C@@H]1CNc1nc(-c2cccnc2)nc2ccccc12 |
| InChI | InChI=1S/C20H23N5/c1-2-25-12-6-8-16(25)14-22-20-17-9-3-4-10-18(17)23-19(24-20)15-7-5-11-21-13-15/h3-5,7,9-11,13,16H,2,6,8,12,14H2,1H3,(H,22,23,24)/p+1/t16-/m1/s1 |
| InChIKey | QUKJBQZWIOODPK-MRXNPFEDSA-O |
| XLogP | 2.17 |
| TPSA | 55.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |