C19H18N6O — CID 133323500
1-(1-methylpyrazol-4-yl)-2-[(2-pyridin-3-ylquinazolin-4-yl)amino]ethanol (PubChem CID 133323500) has the molecular formula C19H18N6O and a molecular weight of 346.39 g/mol. Its IUPAC name is 1-(1-methylpyrazol-4-yl)-2-[(2-pyridin-3-ylquinazolin-4-yl)amino]ethanol.
| Compound Name | 1-(1-methylpyrazol-4-yl)-2-[(2-pyridin-3-ylquinazolin-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 133323500 |
| Molecular Formula | C19H18N6O |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1-(1-methylpyrazol-4-yl)-2-[(2-pyridin-3-ylquinazolin-4-yl)amino]ethanol |
| SMILES | Cn1cc(C(O)CNc2nc(-c3cccnc3)nc3ccccc23)cn1 |
| InChI | InChI=1S/C19H18N6O/c1-25-12-14(10-22-25)17(26)11-21-19-15-6-2-3-7-16(15)23-18(24-19)13-5-4-8-20-9-13/h2-10,12,17,26H,11H2,1H3,(H,21,23,24) |
| InChIKey | BROGAOTWFFADLJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |