C22H21F4N3O — CID 97083925
N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-(trifluoromethyl)quinolin-4-amine (PubChem CID 97083925) has the molecular formula C22H21F4N3O and a molecular weight of 419.42 g/mol. Its IUPAC name is N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-(trifluoromethyl)quinolin-4-amine.
| Compound Name | N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-(trifluoromethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 97083925 |
| Molecular Formula | C22H21F4N3O |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-(trifluoromethyl)quinolin-4-amine |
| SMILES | Fc1ccc([C@H](CNc2cc(C(F)(F)F)nc3ccccc23)N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H21F4N3O/c23-16-7-5-15(6-8-16)20(29-9-11-30-12-10-29)14-27-19-13-21(22(24,25)26)28-18-4-2-1-3-17(18)19/h1-8,13,20H,9-12,14H2,(H,27,28)/t20-/m0/s1 |
| InChIKey | JXKAXIYAJQERSL-FQEVSTJZSA-N |
| XLogP | 4.88 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |