C20H20F3N3OS — CID 97083929
N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-2-(trifluoromethyl)quinolin-4-amine (PubChem CID 97083929) has the molecular formula C20H20F3N3OS and a molecular weight of 407.46 g/mol. Its IUPAC name is N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-2-(trifluoromethyl)quinolin-4-amine.
| Compound Name | N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-2-(trifluoromethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 97083929 |
| Molecular Formula | C20H20F3N3OS |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-2-(trifluoromethyl)quinolin-4-amine |
| SMILES | FC(F)(F)c1cc(NC[C@@H](c2cccs2)N2CCOCC2)c2ccccc2n1 |
| InChI | InChI=1S/C20H20F3N3OS/c21-20(22,23)19-12-16(14-4-1-2-5-15(14)25-19)24-13-17(18-6-3-11-28-18)26-7-9-27-10-8-26/h1-6,11-12,17H,7-10,13H2,(H,24,25)/t17-/m0/s1 |
| InChIKey | QFSKODCWAFORPE-KRWDZBQOSA-N |
| XLogP | 4.80 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |