C22H29N5S — CID 30725151
N-[(2R)-3-methyl-2-(4-methylpiperazin-1-yl)butyl]-2-thiophen-3-ylquinazolin-4-amine (PubChem CID 30725151) has the molecular formula C22H29N5S and a molecular weight of 395.58 g/mol. Its IUPAC name is N-[(2R)-3-methyl-2-(4-methylpiperazin-1-yl)butyl]-2-thiophen-3-ylquinazolin-4-amine.
| Compound Name | N-[(2R)-3-methyl-2-(4-methylpiperazin-1-yl)butyl]-2-thiophen-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 30725151 |
| Molecular Formula | C22H29N5S |
| Molecular Weight | 395.58 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | N-[(2R)-3-methyl-2-(4-methylpiperazin-1-yl)butyl]-2-thiophen-3-ylquinazolin-4-amine |
| SMILES | CC(C)[C@H](CNc1nc(-c2ccsc2)nc2ccccc12)N1CCN(C)CC1 |
| InChI | InChI=1S/C22H29N5S/c1-16(2)20(27-11-9-26(3)10-12-27)14-23-22-18-6-4-5-7-19(18)24-21(25-22)17-8-13-28-15-17/h4-8,13,15-16,20H,9-12,14H2,1-3H3,(H,23,24,25)/t20-/m0/s1 |
| InChIKey | OWZXRRKSEMPDCX-FQEVSTJZSA-N |
| XLogP | 4.04 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |