C17H14N4OS — CID 49430506
N-prop-2-ynyl-2-[(2-thiophen-3-ylquinazolin-4-yl)amino]acetamide (PubChem CID 49430506) has the molecular formula C17H14N4OS and a molecular weight of 322.39 g/mol. Its IUPAC name is N-prop-2-ynyl-2-[(2-thiophen-3-ylquinazolin-4-yl)amino]acetamide.
| Compound Name | N-prop-2-ynyl-2-[(2-thiophen-3-ylquinazolin-4-yl)amino]acetamide |
|---|---|
| PubChem CID | 49430506 |
| Molecular Formula | C17H14N4OS |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | N-prop-2-ynyl-2-[(2-thiophen-3-ylquinazolin-4-yl)amino]acetamide |
| SMILES | C#CCNC(=O)CNc1nc(-c2ccsc2)nc2ccccc12 |
| InChI | InChI=1S/C17H14N4OS/c1-2-8-18-15(22)10-19-17-13-5-3-4-6-14(13)20-16(21-17)12-7-9-23-11-12/h1,3-7,9,11H,8,10H2,(H,18,22)(H,19,20,21) |
| InChIKey | DPDDVFBTKXVOQP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|