C19H17N3O2S — CID 133323931
2-(furan-2-yl)-1-[(2-thiophen-3-ylquinazolin-4-yl)amino]propan-2-ol (PubChem CID 133323931) has the molecular formula C19H17N3O2S and a molecular weight of 351.43 g/mol. Its IUPAC name is 2-(furan-2-yl)-1-[(2-thiophen-3-ylquinazolin-4-yl)amino]propan-2-ol.
| Compound Name | 2-(furan-2-yl)-1-[(2-thiophen-3-ylquinazolin-4-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 133323931 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 2-(furan-2-yl)-1-[(2-thiophen-3-ylquinazolin-4-yl)amino]propan-2-ol |
| SMILES | CC(O)(CNc1nc(-c2ccsc2)nc2ccccc12)c1ccco1 |
| InChI | InChI=1S/C19H17N3O2S/c1-19(23,16-7-4-9-24-16)12-20-18-14-5-2-3-6-15(14)21-17(22-18)13-8-10-25-11-13/h2-11,23H,12H2,1H3,(H,20,21,22) |
| InChIKey | JWWOLPDDTHJUGR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |