C17H20N4S — CID 156820966
N',N'-dimethyl-N-(2-thiophen-3-ylquinazolin-4-yl)propane-1,3-diamine (PubChem CID 156820966) has the molecular formula C17H20N4S and a molecular weight of 312.44 g/mol. Its IUPAC name is N',N'-dimethyl-N-(2-thiophen-3-ylquinazolin-4-yl)propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-(2-thiophen-3-ylquinazolin-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 156820966 |
| Molecular Formula | C17H20N4S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | N',N'-dimethyl-N-(2-thiophen-3-ylquinazolin-4-yl)propane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc(-c2ccsc2)nc2ccccc12 |
| InChI | InChI=1S/C17H20N4S/c1-21(2)10-5-9-18-17-14-6-3-4-7-15(14)19-16(20-17)13-8-11-22-12-13/h3-4,6-8,11-12H,5,9-10H2,1-2H3,(H,18,19,20) |
| InChIKey | WYGYJWFBOYGEER-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|