C22H27Cl2N5 — CID 69071537
N',N'-dimethyl-N-[2-(1-methylindol-2-yl)quinazolin-4-yl]propane-1,3-diamine;dihydrochloride (PubChem CID 69071537) has the molecular formula C22H27Cl2N5 and a molecular weight of 432.40 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-(1-methylindol-2-yl)quinazolin-4-yl]propane-1,3-diamine;dihydrochloride.
| Compound Name | N',N'-dimethyl-N-[2-(1-methylindol-2-yl)quinazolin-4-yl]propane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 69071537 |
| Molecular Formula | C22H27Cl2N5 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | N',N'-dimethyl-N-[2-(1-methylindol-2-yl)quinazolin-4-yl]propane-1,3-diamine;dihydrochloride |
| SMILES | CN(C)CCCNc1nc(-c2cc3ccccc3n2C)nc2ccccc12.Cl.Cl |
| InChI | InChI=1S/C22H25N5.2ClH/c1-26(2)14-8-13-23-21-17-10-5-6-11-18(17)24-22(25-21)20-15-16-9-4-7-12-19(16)27(20)3;;/h4-7,9-12,15H,8,13-14H2,1-3H3,(H,23,24,25);2*1H |
| InChIKey | UWPNYSIEKUTXHD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|