C17H21N5 — CID 156820936
N',N'-dimethyl-N-[2-(1H-pyrrol-3-yl)quinazolin-4-yl]propane-1,3-diamine (PubChem CID 156820936) has the molecular formula C17H21N5 and a molecular weight of 295.39 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-(1H-pyrrol-3-yl)quinazolin-4-yl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[2-(1H-pyrrol-3-yl)quinazolin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 156820936 |
| Molecular Formula | C17H21N5 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | N',N'-dimethyl-N-[2-(1H-pyrrol-3-yl)quinazolin-4-yl]propane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc(-c2cc[nH]c2)nc2ccccc12 |
| InChI | InChI=1S/C17H21N5/c1-22(2)11-5-9-19-17-14-6-3-4-7-15(14)20-16(21-17)13-8-10-18-12-13/h3-4,6-8,10,12,18H,5,9,11H2,1-2H3,(H,19,20,21) |
| InChIKey | ONXNWTUQZBZNQQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|