C17H20N4O2 — CID 170672708
4-[3-(dimethylamino)propylamino]-3H-pyrrolo[2,3-c]quinoline-1-carboxylic acid (PubChem CID 170672708) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 4-[3-(dimethylamino)propylamino]-3H-pyrrolo[2,3-c]quinoline-1-carboxylic acid.
| Compound Name | 4-[3-(dimethylamino)propylamino]-3H-pyrrolo[2,3-c]quinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 170672708 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 4-[3-(dimethylamino)propylamino]-3H-pyrrolo[2,3-c]quinoline-1-carboxylic acid |
| SMILES | CN(C)CCCNc1nc2ccccc2c2c(C(=O)O)c[nH]c12 |
| InChI | InChI=1S/C17H20N4O2/c1-21(2)9-5-8-18-16-15-14(12(10-19-15)17(22)23)11-6-3-4-7-13(11)20-16/h3-4,6-7,10,19H,5,8-9H2,1-2H3,(H,18,20)(H,22,23) |
| InChIKey | NQPDNCBBEHSMFG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|