C23H26F3N5O — CID 58796996
N-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-N-methyl-2-(trifluoromethyl)benzamide (PubChem CID 58796996) has the molecular formula C23H26F3N5O and a molecular weight of 445.49 g/mol. Its IUPAC name is N-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-N-methyl-2-(trifluoromethyl)benzamide.
| Compound Name | N-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-N-methyl-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 58796996 |
| Molecular Formula | C23H26F3N5O |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | N-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-N-methyl-2-(trifluoromethyl)benzamide |
| SMILES | CN(C)CCCNc1nc(CN(C)C(=O)c2ccccc2C(F)(F)F)nc2ccccc12 |
| InChI | InChI=1S/C23H26F3N5O/c1-30(2)14-8-13-27-21-17-10-5-7-12-19(17)28-20(29-21)15-31(3)22(32)16-9-4-6-11-18(16)23(24,25)26/h4-7,9-12H,8,13-15H2,1-3H3,(H,27,28,29) |
| InChIKey | WVSTYCDWYKQVEA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|