C20H29N5O2 — CID 58797471
N-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-N-methyloxolane-3-carboxamide (PubChem CID 58797471) has the molecular formula C20H29N5O2 and a molecular weight of 371.49 g/mol. Its IUPAC name is N-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-N-methyloxolane-3-carboxamide.
| Compound Name | N-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-N-methyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 58797471 |
| Molecular Formula | C20H29N5O2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | N-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-N-methyloxolane-3-carboxamide |
| SMILES | CN(C)CCCNc1nc(CN(C)C(=O)C2CCOC2)nc2ccccc12 |
| InChI | InChI=1S/C20H29N5O2/c1-24(2)11-6-10-21-19-16-7-4-5-8-17(16)22-18(23-19)13-25(3)20(26)15-9-12-27-14-15/h4-5,7-8,15H,6,9-14H2,1-3H3,(H,21,22,23) |
| InChIKey | NXFVEAQHHXQBSQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|