C23H27F3N6O — CID 58797162
1-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-1-methyl-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 58797162) has the molecular formula C23H27F3N6O and a molecular weight of 460.50 g/mol. Its IUPAC name is 1-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-1-methyl-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-1-methyl-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 58797162 |
| Molecular Formula | C23H27F3N6O |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 1-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-1-methyl-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | CN(C)CCCNc1nc(CN(C)C(=O)Nc2ccccc2C(F)(F)F)nc2ccccc12 |
| InChI | InChI=1S/C23H27F3N6O/c1-31(2)14-8-13-27-21-16-9-4-6-11-18(16)28-20(30-21)15-32(3)22(33)29-19-12-7-5-10-17(19)23(24,25)26/h4-7,9-12H,8,13-15H2,1-3H3,(H,29,33)(H,27,28,30) |
| InChIKey | ZMJTUNHHGFBKCN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|