C24H29N5O3 — CID 58796992
2-(1,3-benzodioxol-5-yl)-N-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-N-methylacetamide (PubChem CID 58796992) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-N-methylacetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 58796992 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-N-methylacetamide |
| SMILES | CN(C)CCCNc1nc(CN(C)C(=O)Cc2ccc3c(c2)OCO3)nc2ccccc12 |
| InChI | InChI=1S/C24H29N5O3/c1-28(2)12-6-11-25-24-18-7-4-5-8-19(18)26-22(27-24)15-29(3)23(30)14-17-9-10-20-21(13-17)32-16-31-20/h4-5,7-10,13H,6,11-12,14-16H2,1-3H3,(H,25,26,27) |
| InChIKey | WPKXOQGQPSYHPJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|