C26H32N6O3 — CID 58808887
1,3-benzodioxol-5-yl-[4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]methanone (PubChem CID 58808887) has the molecular formula C26H32N6O3 and a molecular weight of 476.58 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-[4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]methanone.
| Compound Name | 1,3-benzodioxol-5-yl-[4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 58808887 |
| Molecular Formula | C26H32N6O3 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 1,3-benzodioxol-5-yl-[4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]methanone |
| SMILES | CN(C)CCCNc1nc(CN2CCN(C(=O)c3ccc4c(c3)OCO4)CC2)nc2ccccc12 |
| InChI | InChI=1S/C26H32N6O3/c1-30(2)11-5-10-27-25-20-6-3-4-7-21(20)28-24(29-25)17-31-12-14-32(15-13-31)26(33)19-8-9-22-23(16-19)35-18-34-22/h3-4,6-9,16H,5,10-15,17-18H2,1-2H3,(H,27,28,29) |
| InChIKey | OKONBAXCMAMAJH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|