C26H34N6OS — CID 15985034
1-[4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]-2-phenylsulfanylethanone (PubChem CID 15985034) has the molecular formula C26H34N6OS and a molecular weight of 478.67 g/mol. Its IUPAC name is 1-[4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]-2-phenylsulfanylethanone.
| Compound Name | 1-[4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]-2-phenylsulfanylethanone |
|---|---|
| PubChem CID | 15985034 |
| Molecular Formula | C26H34N6OS |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | 1-[4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]-2-phenylsulfanylethanone |
| SMILES | CN(C)CCCNc1nc(CN2CCN(C(=O)CSc3ccccc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C26H34N6OS/c1-30(2)14-8-13-27-26-22-11-6-7-12-23(22)28-24(29-26)19-31-15-17-32(18-16-31)25(33)20-34-21-9-4-3-5-10-21/h3-7,9-12H,8,13-20H2,1-2H3,(H,27,28,29) |
| InChIKey | ZDVFGOXHZCBDGI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|