C25H32ClN7O — CID 58809146
N-(4-chlorophenyl)-4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazine-1-carboxamide (PubChem CID 58809146) has the molecular formula C25H32ClN7O and a molecular weight of 482.03 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazine-1-carboxamide.
| Compound Name | N-(4-chlorophenyl)-4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 58809146 |
| Molecular Formula | C25H32ClN7O |
| Molecular Weight | 482.03 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | N-(4-chlorophenyl)-4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazine-1-carboxamide |
| SMILES | CN(C)CCCNc1nc(CN2CCN(C(=O)Nc3ccc(Cl)cc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C25H32ClN7O/c1-31(2)13-5-12-27-24-21-6-3-4-7-22(21)29-23(30-24)18-32-14-16-33(17-15-32)25(34)28-20-10-8-19(26)9-11-20/h3-4,6-11H,5,12-18H2,1-2H3,(H,28,34)(H,27,29,30) |
| InChIKey | DHLYNIDSEOTSPS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.03 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|